C15H27IN4OS — CID 111027034
1,1,3,3-tetramethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111027034) has the molecular formula C15H27IN4OS and a molecular weight of 438.38 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111027034 |
| Molecular Formula | C15H27IN4OS |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CN(C)C(=NCC(c1cccs1)N1CCOCC1)N(C)C.I |
| InChI | InChI=1S/C15H26N4OS.HI/c1-17(2)15(18(3)4)16-12-13(14-6-5-11-21-14)19-7-9-20-10-8-19;/h5-6,11,13H,7-10,12H2,1-4H3;1H |
| InChIKey | ZKPMZKRELKCFET-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|