C15H27IN4OS — CID 111283658
3-ethyl-1,1-dimethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111283658) has the molecular formula C15H27IN4OS and a molecular weight of 438.38 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1,1-dimethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111283658 |
| Molecular Formula | C15H27IN4OS |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-ethyl-1,1-dimethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N/CC(c1cccs1)N1CCOCC1)N(C)C.I |
| InChI | InChI=1S/C15H26N4OS.HI/c1-4-16-15(18(2)3)17-12-13(14-6-5-11-21-14)19-7-9-20-10-8-19;/h5-6,11,13H,4,7-10,12H2,1-3H3,(H,16,17);1H |
| InChIKey | JSHZNXJCTKLDLG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|