C20H27FIN5O — CID 111028097
2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111028097) has the molecular formula C20H27FIN5O and a molecular weight of 499.37 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111028097 |
| Molecular Formula | C20H27FIN5O |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)NCCc1ccccn1 |
| InChI | InChI=1S/C20H26FN5O.HI/c21-17-6-4-16(5-7-17)19(26-11-13-27-14-12-26)15-25-20(22)24-10-8-18-3-1-2-9-23-18;/h1-7,9,19H,8,10-15H2,(H3,22,24,25);1H |
| InChIKey | YMKDTLFKHMNVFP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|