C20H28N4O3 — CID 111028912
1-(3,4-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]guanidine (PubChem CID 111028912) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111028912 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC(c2ccccc2OC)N(C)C)cc1OC |
| InChI | InChI=1S/C20H28N4O3/c1-24(2)16(15-8-6-7-9-17(15)25-3)13-22-20(21)23-14-10-11-18(26-4)19(12-14)27-5/h6-12,16H,13H2,1-5H3,(H3,21,22,23) |
| InChIKey | OJBOJVSSLZWFKC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|