C24H44O6Si2 — CID 11102950
[(2S,3S,3aS,4R,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-5-oxo-8-trimethylsilyloxy-1,2,3,3a,4,6,7,8a-octahydroazulen-4-yl] 2-oxopropanoate (PubChem CID 11102950) has the molecular formula C24H44O6Si2 and a molecular weight of 484.78 g/mol. Its IUPAC name is [(2S,3S,3aS,4R,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-5-oxo-8-trimethylsilyloxy-1,2,3,3a,4,6,7,8a-octahydroazulen-4-yl] 2-oxopropanoate.
| Compound Name | [(2S,3S,3aS,4R,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-5-oxo-8-trimethylsilyloxy-1,2,3,3a,4,6,7,8a-octahydroazulen-4-yl] 2-oxopropanoate |
|---|---|
| PubChem CID | 11102950 |
| Molecular Formula | C24H44O6Si2 |
| Molecular Weight | 484.78 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | [(2S,3S,3aS,4R,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-5-oxo-8-trimethylsilyloxy-1,2,3,3a,4,6,7,8a-octahydroazulen-4-yl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)O[C@H]1C(=O)CC[C@@](C)(O[Si](C)(C)C)[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H]21 |
| InChI | InChI=1S/C24H44O6Si2/c1-15-19(29-32(10,11)23(3,4)5)14-17-20(15)21(28-22(27)16(2)25)18(26)12-13-24(17,6)30-31(7,8)9/h15,17,19-21H,12-14H2,1-11H3/t15-,17-,19+,20+,21+,24-/m1/s1 |
| InChIKey | VCLIKTYJKBEFDZ-UFLCQEFISA-N |
| XLogP | 5.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.78 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|