C18H31N5OS — CID 111029856
1-(3-morpholin-4-ylpropyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111029856) has the molecular formula C18H31N5OS and a molecular weight of 365.55 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111029856 |
| Molecular Formula | C18H31N5OS |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\CC(c1cccs1)N1CCCC1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H31N5OS/c19-18(20-6-4-7-22-10-12-24-13-11-22)21-15-16(17-5-3-14-25-17)23-8-1-2-9-23/h3,5,14,16H,1-2,4,6-13,15H2,(H3,19,20,21) |
| InChIKey | HUYAQOCZKFQLLC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|