C28H30O3S3 — CID 11103230
tert-butyl 2,2-bis(phenylsulfanyl)-2-[(E)-4-phenylsulfanylbut-3-enoxy]acetate (PubChem CID 11103230) has the molecular formula C28H30O3S3 and a molecular weight of 510.75 g/mol. Its IUPAC name is tert-butyl 2,2-bis(phenylsulfanyl)-2-[(E)-4-phenylsulfanylbut-3-enoxy]acetate.
| Compound Name | tert-butyl 2,2-bis(phenylsulfanyl)-2-[(E)-4-phenylsulfanylbut-3-enoxy]acetate |
|---|---|
| PubChem CID | 11103230 |
| Molecular Formula | C28H30O3S3 |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | tert-butyl 2,2-bis(phenylsulfanyl)-2-[(E)-4-phenylsulfanylbut-3-enoxy]acetate |
| SMILES | CC(C)(C)OC(=O)C(OCC/C=C/Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C28H30O3S3/c1-27(2,3)31-26(29)28(33-24-17-9-5-10-18-24,34-25-19-11-6-12-20-25)30-21-13-14-22-32-23-15-7-4-8-16-23/h4-12,14-20,22H,13,21H2,1-3H3/b22-14+ |
| InChIKey | BHYZYYLKVHRTFL-HYARGMPZSA-N |
| XLogP | 8.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|