C16H22O3S — CID 85308894
tert-butyl 2-(4-phenylsulfanylbut-3-enoxy)acetate (PubChem CID 85308894) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is tert-butyl 2-(4-phenylsulfanylbut-3-enoxy)acetate.
| Compound Name | tert-butyl 2-(4-phenylsulfanylbut-3-enoxy)acetate |
|---|---|
| PubChem CID | 85308894 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | tert-butyl 2-(4-phenylsulfanylbut-3-enoxy)acetate |
| SMILES | CC(C)(C)OC(=O)COCCC=CSc1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-16(2,3)19-15(17)13-18-11-7-8-12-20-14-9-5-4-6-10-14/h4-6,8-10,12H,7,11,13H2,1-3H3 |
| InChIKey | IOPVUFZAUOLUAI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|