C19H30N4O3 — CID 111032608
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine (PubChem CID 111032608) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111032608 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
| SMILES | CC(C)CN1CCOC(C/N=C(\N)Nc2ccc3c(c2)OCCCO3)C1 |
| InChI | InChI=1S/C19H30N4O3/c1-14(2)12-23-6-9-24-16(13-23)11-21-19(20)22-15-4-5-17-18(10-15)26-8-3-7-25-17/h4-5,10,14,16H,3,6-9,11-13H2,1-2H3,(H3,20,21,22) |
| InChIKey | SEBPEZRQKALPOD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|