C23H37IN4O3 — CID 111864047
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-methylcyclopropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111864047) has the molecular formula C23H37IN4O3 and a molecular weight of 544.48 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-methylcyclopropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-methylcyclopropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111864047 |
| Molecular Formula | C23H37IN4O3 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-methylcyclopropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CC(C)CN1CCOC(C/N=C(/Nc2ccc3c(c2)OCCCO3)NC2CC2C)C1.I |
| InChI | InChI=1S/C23H36N4O3.HI/c1-16(2)14-27-7-10-28-19(15-27)13-24-23(26-20-11-17(20)3)25-18-5-6-21-22(12-18)30-9-4-8-29-21;/h5-6,12,16-17,19-20H,4,7-11,13-15H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | JYCCUFSMYDQFIC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|