C23H40N4O3 — CID 111494370
1-(3-methoxypropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111494370) has the molecular formula C23H40N4O3 and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 1-(3-methoxypropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111494370 |
| Molecular Formula | C23H40N4O3 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | 1-(3-methoxypropyl)-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | COCCCN/C(=N\CC1CN(CC(C)C)CCO1)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C23H40N4O3/c1-18(2)16-27-12-14-29-22(17-27)15-25-23(24-11-6-13-28-5)26-20-7-9-21(10-8-20)30-19(3)4/h7-10,18-19,22H,6,11-17H2,1-5H3,(H2,24,25,26) |
| InChIKey | XXZHLCZRSVSPAA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|