C14H25IN4 — CID 111033123
1-butyl-2-[[4-(dimethylamino)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111033123) has the molecular formula C14H25IN4 and a molecular weight of 376.29 g/mol. Its IUPAC name is 1-butyl-2-[[4-(dimethylamino)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[[4-(dimethylamino)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033123 |
| Molecular Formula | C14H25IN4 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-butyl-2-[[4-(dimethylamino)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/Cc1ccc(N(C)C)cc1.I |
| InChI | InChI=1S/C14H24N4.HI/c1-4-5-10-16-14(15)17-11-12-6-8-13(9-7-12)18(2)3;/h6-9H,4-5,10-11H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | GBPDCJFFWNEHCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|