C15H24N4O — CID 111040921
4-[[[amino(butylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111040921) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[[[amino(butylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[amino(butylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111040921 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[[[amino(butylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCCCN/C(N)=N/Cc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C15H24N4O/c1-4-5-10-17-15(16)18-11-12-6-8-13(9-7-12)14(20)19(2)3/h6-9H,4-5,10-11H2,1-3H3,(H3,16,17,18) |
| InChIKey | NYFBSKOXAJOULZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|