C20H25N3O — CID 111034965
1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methoxy-5-methylphenyl)ethyl]guanidine (PubChem CID 111034965) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methoxy-5-methylphenyl)ethyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methoxy-5-methylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111034965 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methoxy-5-methylphenyl)ethyl]guanidine |
| SMILES | COc1ccc(C)cc1CC/N=C(\N)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H25N3O/c1-14-6-9-19(24-2)17(12-14)10-11-22-20(21)23-18-8-7-15-4-3-5-16(15)13-18/h6-9,12-13H,3-5,10-11H2,1-2H3,(H3,21,22,23) |
| InChIKey | KDGZKLRSJQQATL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|