C16H20N4S — CID 122097435
1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]guanidine (PubChem CID 122097435) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 122097435 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]guanidine |
| SMILES | Cc1ncsc1CC/N=C(\N)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H20N4S/c1-11-15(21-10-19-11)7-8-18-16(17)20-14-6-5-12-3-2-4-13(12)9-14/h5-6,9-10H,2-4,7-8H2,1H3,(H3,17,18,20) |
| InChIKey | OGJJNIHEWZWGNG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|