C14H28IN3O2 — CID 111036029
2-(cyclobutylmethyl)-1-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111036029) has the molecular formula C14H28IN3O2 and a molecular weight of 397.30 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-(cyclobutylmethyl)-1-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111036029 |
| Molecular Formula | C14H28IN3O2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCC1)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C14H27N3O2.HI/c15-14(17-10-12-4-1-5-12)16-7-3-8-18-11-13-6-2-9-19-13;/h12-13H,1-11H2,(H3,15,16,17);1H |
| InChIKey | FHJONPWHXBPAME-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|