C9H20IN3O2 — CID 111414866
2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111414866) has the molecular formula C9H20IN3O2 and a molecular weight of 329.18 g/mol. Its IUPAC name is 2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111414866 |
| Molecular Formula | C9H20IN3O2 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\N)NCCOCC1CCCO1.I |
| InChI | InChI=1S/C9H19N3O2.HI/c1-11-9(10)12-4-6-13-7-8-3-2-5-14-8;/h8H,2-7H2,1H3,(H3,10,11,12);1H |
| InChIKey | TUZAESQAGWKYOD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|