C14H24N4O2S — CID 111037892
1,1,3,3-tetramethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111037892) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111037892 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | CNS(=O)(=O)Cc1ccc(CN=C(N(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C14H24N4O2S/c1-15-21(19,20)11-13-8-6-12(7-9-13)10-16-14(17(2)3)18(4)5/h6-9,15H,10-11H2,1-5H3 |
| InChIKey | XVPBYTQFEBFBLO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|