C17H25IN4O2S — CID 111041298
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111041298) has the molecular formula C17H25IN4O2S and a molecular weight of 476.38 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111041298 |
| Molecular Formula | C17H25IN4O2S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CCc2csc(C)n2)cc1OC.I |
| InChI | InChI=1S/C17H24N4O2S.HI/c1-12-21-14(11-24-12)7-9-20-17(18)19-8-6-13-4-5-15(22-2)16(10-13)23-3;/h4-5,10-11H,6-9H2,1-3H3,(H3,18,19,20);1H |
| InChIKey | OPAVJGRZBXKHAG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|