C20H32N6O2 — CID 111041439
tert-butyl 4-[N'-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111041439) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is tert-butyl 4-[N'-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111041439 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | tert-butyl 4-[N'-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/Cc2ccnc(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C20H32N6O2/c1-20(2,3)28-19(27)26-12-10-25(11-13-26)18(21)23-15-16-6-7-22-17(14-16)24-8-4-5-9-24/h6-7,14H,4-5,8-13,15H2,1-3H3,(H2,21,23) |
| InChIKey | AOBAGXGOXROINJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|