C36H51NO2Sn — CID 11104226
tributyl-[(2S,3R)-3-(methoxymethoxymethyl)-1-tritylaziridin-2-yl]stannane (PubChem CID 11104226) has the molecular formula C36H51NO2Sn and a molecular weight of 648.52 g/mol. Its IUPAC name is tributyl-[(2S,3R)-3-(methoxymethoxymethyl)-1-tritylaziridin-2-yl]stannane.
| Compound Name | tributyl-[(2S,3R)-3-(methoxymethoxymethyl)-1-tritylaziridin-2-yl]stannane |
|---|---|
| PubChem CID | 11104226 |
| Molecular Formula | C36H51NO2Sn |
| Molecular Weight | 648.52 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | tributyl-[(2S,3R)-3-(methoxymethoxymethyl)-1-tritylaziridin-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H]1[C@@H](COCOC)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24NO2.3C4H9.Sn/c1-26-19-27-18-23-17-25(23)24(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22;3*1-3-4-2;/h2-17,23H,18-19H2,1H3;3*1,3-4H2,2H3;/t23-,25?;;;;/m0..../s1 |
| InChIKey | OELPZSPMAHGOIK-QFLQLVHMSA-N |
| XLogP | 9.04 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.52 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|