C24H24ClNO2 — CID 11132987
(2S,3R)-2-chloro-3-(methoxymethoxymethyl)-1-tritylaziridine (PubChem CID 11132987) has the molecular formula C24H24ClNO2 and a molecular weight of 393.91 g/mol. Its IUPAC name is (2S,3R)-2-chloro-3-(methoxymethoxymethyl)-1-tritylaziridine.
| Compound Name | (2S,3R)-2-chloro-3-(methoxymethoxymethyl)-1-tritylaziridine |
|---|---|
| PubChem CID | 11132987 |
| Molecular Formula | C24H24ClNO2 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (2S,3R)-2-chloro-3-(methoxymethoxymethyl)-1-tritylaziridine |
| SMILES | COCOC[C@@H]1[C@H](Cl)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24ClNO2/c1-27-18-28-17-22-23(25)26(22)24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-23H,17-18H2,1H3/t22-,23-,26?/m1/s1 |
| InChIKey | JNVXBQQUWXTPLZ-JIISWEIGSA-N |
| XLogP | 4.85 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|