C30H29NO2 — CID 134985606
(2S,3R)-2-(methoxymethoxymethyl)-3-phenyl-1-tritylaziridine (PubChem CID 134985606) has the molecular formula C30H29NO2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (2S,3R)-2-(methoxymethoxymethyl)-3-phenyl-1-tritylaziridine.
| Compound Name | (2S,3R)-2-(methoxymethoxymethyl)-3-phenyl-1-tritylaziridine |
|---|---|
| PubChem CID | 134985606 |
| Molecular Formula | C30H29NO2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (2S,3R)-2-(methoxymethoxymethyl)-3-phenyl-1-tritylaziridine |
| SMILES | COCOC[C@@H]1[C@@H](c2ccccc2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29NO2/c1-32-23-33-22-28-29(24-14-6-2-7-15-24)31(28)30(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,28-29H,22-23H2,1H3/t28-,29-,31?/m1/s1 |
| InChIKey | VCKJZUOXLZDMQK-FYZJSYNQSA-N |
| XLogP | 6.02 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|