C24H25NO2 — CID 134905501
(3R)-2-(methoxymethoxymethyl)-3-tritylaziridine (PubChem CID 134905501) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3R)-2-(methoxymethoxymethyl)-3-tritylaziridine.
| Compound Name | (3R)-2-(methoxymethoxymethyl)-3-tritylaziridine |
|---|---|
| PubChem CID | 134905501 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3R)-2-(methoxymethoxymethyl)-3-tritylaziridine |
| SMILES | COCOCC1N[C@@H]1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO2/c1-26-18-27-17-22-23(25-22)24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-23,25H,17-18H2,1H3/t22?,23-/m0/s1 |
| InChIKey | FWUDZZBCDSVLGW-WCSIJFPASA-N |
| XLogP | 3.98 |
| TPSA | 40.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|