C33H32N2O — CID 102380256
2-[(2S,3S)-3-benzyl-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 102380256) has the molecular formula C33H32N2O and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[(2S,3S)-3-benzyl-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2S,3S)-3-benzyl-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 102380256 |
| Molecular Formula | C33H32N2O |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-[(2S,3S)-3-benzyl-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@@H]2[C@H](Cc3ccccc3)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C33H32N2O/c1-32(2)24-36-31(34-32)30-29(23-25-15-7-3-8-16-25)35(30)33(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30H,23-24H2,1-2H3/t29-,30-,35?/m0/s1 |
| InChIKey | UNESCJSVCSJMNL-ATWHQSCISA-N |
| XLogP | 6.48 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|