C31H36N2O2 — CID 134998508
3-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]pentan-3-ol (PubChem CID 134998508) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is 3-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]pentan-3-ol.
| Compound Name | 3-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 134998508 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 3-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]pentan-3-ol |
| SMILES | CCC(O)(CC)C1C(C2=NC(C)(C)CO2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O2/c1-5-30(34,6-2)27-26(28-32-29(3,4)22-35-28)33(27)31(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,26-27,34H,5-6,22H2,1-4H3 |
| InChIKey | YKDPARRDDICBRF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 44.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|