C16H22N2O — CID 134836521
4,4-dimethyl-2-[(2S)-1-(2-phenylpropan-2-yl)aziridin-2-yl]-5H-1,3-oxazole (PubChem CID 134836521) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2S)-1-(2-phenylpropan-2-yl)aziridin-2-yl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[(2S)-1-(2-phenylpropan-2-yl)aziridin-2-yl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 134836521 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4,4-dimethyl-2-[(2S)-1-(2-phenylpropan-2-yl)aziridin-2-yl]-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@@H]2CN2C(C)(C)c2ccccc2)=N1 |
| InChI | InChI=1S/C16H22N2O/c1-15(2)11-19-14(17-15)13-10-18(13)16(3,4)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3/t13-,18?/m0/s1 |
| InChIKey | QAQMIKAYJKCCLR-FVRDMJKUSA-N |
| XLogP | 2.81 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|