C29H34N2OSi — CID 102380254
[(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-trimethylsilane (PubChem CID 102380254) has the molecular formula C29H34N2OSi and a molecular weight of 454.69 g/mol. Its IUPAC name is [(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-trimethylsilane.
| Compound Name | [(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102380254 |
| Molecular Formula | C29H34N2OSi |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-trimethylsilane |
| SMILES | CC1(C)COC([C@@H]2[C@H]([Si](C)(C)C)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C29H34N2OSi/c1-28(2)21-32-26(30-28)25-27(33(3,4)5)31(25)29(22-15-9-6-10-16-22,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-20,25,27H,21H2,1-5H3/t25-,27+,31?/m1/s1 |
| InChIKey | VHWBUHLFSKKDEA-JRMBDLRJSA-N |
| XLogP | 6.12 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|