C27H33NO2 — CID 86278536
(1S)-N,N-dibenzyl-3,3-diethoxy-1-phenylpropan-1-amine (PubChem CID 86278536) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (1S)-N,N-dibenzyl-3,3-diethoxy-1-phenylpropan-1-amine.
| Compound Name | (1S)-N,N-dibenzyl-3,3-diethoxy-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 86278536 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (1S)-N,N-dibenzyl-3,3-diethoxy-1-phenylpropan-1-amine |
| SMILES | CCOC(C[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1)OCC |
| InChI | InChI=1S/C27H33NO2/c1-3-29-27(30-4-2)20-26(25-18-12-7-13-19-25)28(21-23-14-8-5-9-15-23)22-24-16-10-6-11-17-24/h5-19,26-27H,3-4,20-22H2,1-2H3/t26-/m0/s1 |
| InChIKey | MEADOXAQAXDZAZ-SANMLTNESA-N |
| XLogP | 6.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|