C35H49NO2Sn — CID 134883974
tributyl-[(2S,3R)-3-(methoxymethoxy)-1-tritylaziridin-2-yl]stannane (PubChem CID 134883974) has the molecular formula C35H49NO2Sn and a molecular weight of 634.49 g/mol. Its IUPAC name is tributyl-[(2S,3R)-3-(methoxymethoxy)-1-tritylaziridin-2-yl]stannane.
| Compound Name | tributyl-[(2S,3R)-3-(methoxymethoxy)-1-tritylaziridin-2-yl]stannane |
|---|---|
| PubChem CID | 134883974 |
| Molecular Formula | C35H49NO2Sn |
| Molecular Weight | 634.49 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | tributyl-[(2S,3R)-3-(methoxymethoxy)-1-tritylaziridin-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H]1[C@@H](OCOC)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22NO2.3C4H9.Sn/c1-25-18-26-22-17-24(22)23(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;3*1-3-4-2;/h2-17,22H,18H2,1H3;3*1,3-4H2,2H3;/t22-,24?;;;;/m1..../s1 |
| InChIKey | GELMQDRPEXNKRR-NAXCBBDMSA-N |
| XLogP | 9.00 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.49 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|