C26H46O4 — CID 151224726
(2-butoxy-1,1,1-triethoxydecan-2-yl)benzene (PubChem CID 151224726) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene.
| Compound Name | (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene |
|---|---|
| PubChem CID | 151224726 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene |
| SMILES | CCCCCCCCC(OCCCC)(c1ccccc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C26H46O4/c1-6-11-13-14-15-19-22-25(30-23-12-7-2,24-20-17-16-18-21-24)26(27-8-3,28-9-4)29-10-5/h16-18,20-21H,6-15,19,22-23H2,1-5H3 |
| InChIKey | NNAKBJRPHTZLQY-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|