About (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene
(2-butoxy-1,1,1-triethoxydecan-2-yl)benzene (PubChem CID 151224726) has the molecular formula C26H46O4
and a molecular weight of 422.65 g/mol. Its IUPAC name is (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene.
Molecular Properties
| Compound Name | (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene |
| PubChem CID | 151224726 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene |
| SMILES | CCCCCCCCC(OCCCC)(c1ccccc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C26H46O4/c1-6-11-13-14-15-19-22-25(30-23-12-7-2,24-20-17-16-18-21-24)26(27-8-3,28-9-4)29-10-5/h16-18,20-21H,6-15,19,22-23H2,1-5H3 |
| InChIKey | NNAKBJRPHTZLQY-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene?
The IUPAC name of (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene (CID 151224726) is (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene.
What is the SMILES notation for (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene?
The canonical SMILES for (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene is CCCCCCCCC(OCCCC)(c1ccccc1)C(OCC)(OCC)OCC.
What is the InChIKey of (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene?
The InChIKey is NNAKBJRPHTZLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H46O4/c1-6-11-13-14-15-19-22-25(30-23-12-7-2,24-20-17-16-18-21-24)26(27-8-3,28-9-4)29-10-5/h16-18,20-21H,6-15,19,22-23H2,1-5H3.
What are the key properties of (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene?
(2-butoxy-1,1,1-triethoxydecan-2-yl)benzene has a molecular weight of 422.65 g/mol, XLogP of 7.21, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butoxy-1,1,1-triethoxydecan-2-yl)benzene is sourced from PubChem (CID 151224726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).