C25H44O4 — CID 150875588
[1,1,1-triethoxy-2-(ethoxymethyl)decan-2-yl]benzene (PubChem CID 150875588) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is [1,1,1-triethoxy-2-(ethoxymethyl)decan-2-yl]benzene.
| Compound Name | [1,1,1-triethoxy-2-(ethoxymethyl)decan-2-yl]benzene |
|---|---|
| PubChem CID | 150875588 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | [1,1,1-triethoxy-2-(ethoxymethyl)decan-2-yl]benzene |
| SMILES | CCCCCCCCC(COCC)(c1ccccc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C25H44O4/c1-6-11-12-13-14-18-21-24(22-26-7-2,23-19-16-15-17-20-23)25(27-8-3,28-9-4)29-10-5/h15-17,19-20H,6-14,18,21-22H2,1-5H3 |
| InChIKey | KUXZARPWHVFOBR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|