About 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine
9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine (PubChem CID 159765705) has the molecular formula C38H55NO3
and a molecular weight of 573.86 g/mol. Its IUPAC name is 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine.
Molecular Properties
| Compound Name | 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine |
| PubChem CID | 159765705 |
| Molecular Formula | C38H55NO3 |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.42 |
| IUPAC Name | 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine |
| SMILES | CCCCCCCCC(CCCN)(c1ccccc1)C(OCC)(OCC)OCC.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C25H45NO3.C13H10/c1-5-9-10-11-12-16-20-24(21-17-22-26,23-18-14-13-15-19-23)25(27-6-2,28-7-3)29-8-4;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h13-15,18-19H,5-12,16-17,20-22,26H2,1-4H3;1-8H,9H2 |
| InChIKey | NFLVHBUFIZKBBQ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine?
The IUPAC name of 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine (CID 159765705) is 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine.
What is the SMILES notation for 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine?
The canonical SMILES for 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine is CCCCCCCCC(CCCN)(c1ccccc1)C(OCC)(OCC)OCC.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine?
The InChIKey is NFLVHBUFIZKBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H45NO3.C13H10/c1-5-9-10-11-12-16-20-24(21-17-22-26,23-18-14-13-15-19-23)25(27-6-2,28-7-3)29-8-4;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h13-15,18-19H,5-12,16-17,20-22,26H2,1-4H3;1-8H,9H2.
What are the key properties of 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine?
9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine has a molecular weight of 573.86 g/mol, XLogP of 9.44, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;4-phenyl-4-(triethoxymethyl)dodecan-1-amine is sourced from PubChem (CID 159765705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).