C24H26FNO2 — CID 71490599
N,N-dibenzyl-1-(4-fluorophenyl)-2,2-dimethoxyethanamine (PubChem CID 71490599) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is N,N-dibenzyl-1-(4-fluorophenyl)-2,2-dimethoxyethanamine.
| Compound Name | N,N-dibenzyl-1-(4-fluorophenyl)-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 71490599 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N,N-dibenzyl-1-(4-fluorophenyl)-2,2-dimethoxyethanamine |
| SMILES | COC(OC)C(c1ccc(F)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26FNO2/c1-27-24(28-2)23(21-13-15-22(25)16-14-21)26(17-19-9-5-3-6-10-19)18-20-11-7-4-8-12-20/h3-16,23-24H,17-18H2,1-2H3 |
| InChIKey | NFIAPYVENQKLSI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|