C16H35IN4 — CID 111042486
N'-[2-(diethylamino)-4-methylpentyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111042486) has the molecular formula C16H35IN4 and a molecular weight of 410.39 g/mol. Its IUPAC name is N'-[2-(diethylamino)-4-methylpentyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(diethylamino)-4-methylpentyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111042486 |
| Molecular Formula | C16H35IN4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N'-[2-(diethylamino)-4-methylpentyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC)C(C/N=C(\N)N1CCCCC1)CC(C)C.I |
| InChI | InChI=1S/C16H34N4.HI/c1-5-19(6-2)15(12-14(3)4)13-18-16(17)20-10-8-7-9-11-20;/h14-15H,5-13H2,1-4H3,(H2,17,18);1H |
| InChIKey | YKERADJFSZPXQU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|