C16H24IN5 — CID 111042590
1-(3,5-dimethylphenyl)-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111042590) has the molecular formula C16H24IN5 and a molecular weight of 413.31 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111042590 |
| Molecular Formula | C16H24IN5 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCCc2cn[nH]c2C)c1.I |
| InChI | InChI=1S/C16H23N5.HI/c1-11-7-12(2)9-15(8-11)20-16(17)18-6-4-5-14-10-19-21-13(14)3;/h7-10H,4-6H2,1-3H3,(H,19,21)(H3,17,18,20);1H |
| InChIKey | AJMYPCPNMJFAGQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|