C16H28IN5O — CID 111049111
2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-propylguanidine;hydroiodide (PubChem CID 111049111) has the molecular formula C16H28IN5O and a molecular weight of 433.34 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111049111 |
| Molecular Formula | C16H28IN5O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/Cc1ccc(N2CC(C)OC(C)C2)nc1.I |
| InChI | InChI=1S/C16H27N5O.HI/c1-4-7-18-16(17)20-9-14-5-6-15(19-8-14)21-10-12(2)22-13(3)11-21;/h5-6,8,12-13H,4,7,9-11H2,1-3H3,(H3,17,18,20);1H |
| InChIKey | KRJWSHFEFWCONW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|