C21H37N5O — CID 111049126
2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(6-methylheptan-2-yl)guanidine (PubChem CID 111049126) has the molecular formula C21H37N5O and a molecular weight of 375.56 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(6-methylheptan-2-yl)guanidine.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111049126 |
| Molecular Formula | C21H37N5O |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(6-methylheptan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/Cc1ccc(N2CC(C)OC(C)C2)nc1 |
| InChI | InChI=1S/C21H37N5O/c1-15(2)7-6-8-16(3)25-21(22)24-12-19-9-10-20(23-11-19)26-13-17(4)27-18(5)14-26/h9-11,15-18H,6-8,12-14H2,1-5H3,(H3,22,24,25) |
| InChIKey | XZINBIXENMBZPN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|