C17H29N5 — CID 111049216
2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111049216) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111049216 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCc1ccc(N2CCCCCC2)nc1)N(C)C |
| InChI | InChI=1S/C17H29N5/c1-20(2)17(21(3)4)19-14-15-9-10-16(18-13-15)22-11-7-5-6-8-12-22/h9-10,13H,5-8,11-12,14H2,1-4H3 |
| InChIKey | IDMJEEFVMGVERC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|