C13H20F3IN4O — CID 111050367
1,1-diethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111050367) has the molecular formula C13H20F3IN4O and a molecular weight of 432.23 g/mol. Its IUPAC name is 1,1-diethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111050367 |
| Molecular Formula | C13H20F3IN4O |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1,1-diethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1cccnc1OCC(F)(F)F.I |
| InChI | InChI=1S/C13H19F3N4O.HI/c1-3-20(4-2)12(17)19-8-10-6-5-7-18-11(10)21-9-13(14,15)16;/h5-7H,3-4,8-9H2,1-2H3,(H2,17,19);1H |
| InChIKey | ACJCRRMPOFUNTN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|