C21H28N4O3 — CID 111050818
N'-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111050818) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N'-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111050818 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N'-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | COc1cccc(OC)c1Oc1ccc(C/N=C(\N)N2CCCC(C)C2)cn1 |
| InChI | InChI=1S/C21H28N4O3/c1-15-6-5-11-25(14-15)21(22)24-13-16-9-10-19(23-12-16)28-20-17(26-2)7-4-8-18(20)27-3/h4,7-10,12,15H,5-6,11,13-14H2,1-3H3,(H2,22,24) |
| InChIKey | LCZJUOOLHKWYLU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|