C18H26N4O — CID 111052563
N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 111052563) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111052563 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(CN2CCCC2=O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H26N4O/c19-18(21-10-2-1-3-11-21)20-13-15-6-8-16(9-7-15)14-22-12-4-5-17(22)23/h6-9H,1-5,10-14H2,(H2,19,20) |
| InChIKey | VIXLARRIYSPRNG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|