C17H24N4O — CID 54731320
1-(2-methylprop-2-enyl)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 54731320) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-(2-methylprop-2-enyl)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 54731320 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C17H24N4O/c1-13(2)10-19-17(18)20-11-14-5-7-15(8-6-14)12-21-9-3-4-16(21)22/h5-8H,1,3-4,9-12H2,2H3,(H3,18,19,20) |
| InChIKey | HDMJIQBKRBQBAE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|