C16H25N5O — CID 111067290
1-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111067290) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111067290 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccc(NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H25N5O/c1-11(2)9-18-15(17)19-10-13-5-7-14(8-6-13)21-16(22)20-12(3)4/h5-8,12H,1,9-10H2,2-4H3,(H3,17,18,19)(H2,20,21,22) |
| InChIKey | XUSYKEMPQKEBPJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|