C16H24N4O — CID 111061551
N-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]butanamide (PubChem CID 111061551) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is N-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111061551 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[4-[[[amino-(2-methylprop-2-enylamino)methylidene]amino]methyl]phenyl]butanamide |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccc(NC(=O)CCC)cc1 |
| InChI | InChI=1S/C16H24N4O/c1-4-5-15(21)20-14-8-6-13(7-9-14)11-19-16(17)18-10-12(2)3/h6-9H,2,4-5,10-11H2,1,3H3,(H,20,21)(H3,17,18,19) |
| InChIKey | ZQVMFNKHSQZWFY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|