C8H12O — CID 11105363
3-(methoxymethyl)hexa-1,2,5-triene (PubChem CID 11105363) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is 3-(methoxymethyl)hexa-1,2,5-triene.
| Compound Name | 3-(methoxymethyl)hexa-1,2,5-triene |
|---|---|
| PubChem CID | 11105363 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 3-(methoxymethyl)hexa-1,2,5-triene |
| SMILES | C=C=C(CC=C)COC |
| InChI | InChI=1S/C8H12O/c1-4-6-8(5-2)7-9-3/h4H,1-2,6-7H2,3H3 |
| InChIKey | IXMBGIULMAIQJW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|