About 3-methoxyhepta-1,6-diene
3-methoxyhepta-1,6-diene (PubChem CID 87414233) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 3-methoxyhepta-1,6-diene.
Molecular Properties
| Compound Name | 3-methoxyhepta-1,6-diene |
| PubChem CID | 87414233 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 3-methoxyhepta-1,6-diene |
| SMILES | C=CCCC(C=C)OC |
| InChI | InChI=1S/C8H14O/c1-4-6-7-8(5-2)9-3/h4-5,8H,1-2,6-7H2,3H3 |
| InChIKey | NRMDMKZVSGDRBS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyhepta-1,6-diene?
The IUPAC name of 3-methoxyhepta-1,6-diene (CID 87414233) is 3-methoxyhepta-1,6-diene.
What is the SMILES notation for 3-methoxyhepta-1,6-diene?
The canonical SMILES for 3-methoxyhepta-1,6-diene is C=CCCC(C=C)OC.
What is the InChIKey of 3-methoxyhepta-1,6-diene?
The InChIKey is NRMDMKZVSGDRBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-4-6-7-8(5-2)9-3/h4-5,8H,1-2,6-7H2,3H3.
What are the key properties of 3-methoxyhepta-1,6-diene?
3-methoxyhepta-1,6-diene has a molecular weight of 126.20 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyhepta-1,6-diene is sourced from PubChem (CID 87414233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).