C18H30N4 — CID 111055439
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111055439) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111055439 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCC(C)(C)N1CCc2ccccc2C1)N(C)C |
| InChI | InChI=1S/C18H30N4/c1-18(2,14-19-17(20(3)4)21(5)6)22-12-11-15-9-7-8-10-16(15)13-22/h7-10H,11-14H2,1-6H3 |
| InChIKey | CIGVNCJBZXMVPJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|