C10H18O — CID 11105579
(3S,5E)-3,7-dimethylocta-5,7-dien-1-ol (PubChem CID 11105579) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (3S,5E)-3,7-dimethylocta-5,7-dien-1-ol.
| Compound Name | (3S,5E)-3,7-dimethylocta-5,7-dien-1-ol |
|---|---|
| PubChem CID | 11105579 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (3S,5E)-3,7-dimethylocta-5,7-dien-1-ol |
| SMILES | C=C(C)/C=C/C[C@H](C)CCO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h4-5,10-11H,1,6-8H2,2-3H3/b5-4+/t10-/m0/s1 |
| InChIKey | JKTVYCMZESYUII-YEZKRMTDSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|