C13H23N5 — CID 111055975
2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111055975) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111055975 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCc1cccnc1N(C)C)N(C)C |
| InChI | InChI=1S/C13H23N5/c1-16(2)12-11(8-7-9-14-12)10-15-13(17(3)4)18(5)6/h7-9H,10H2,1-6H3 |
| InChIKey | ARQKZFNLINMJSE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 34.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|